About [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride
[1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride (PubChem CID 19879188) has the molecular formula C13H19ClN4O3S
and a molecular weight of 346.84 g/mol. Its IUPAC name is [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride |
| PubChem CID | 19879188 |
| Molecular Formula | C13H19ClN4O3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)CC1(COc2ccc3nccn3n2)CCCC1 |
| InChI | InChI=1S/C13H18N4O3S.ClH/c14-21(18,19)10-13(5-1-2-6-13)9-20-12-4-3-11-15-7-8-17(11)16-12;/h3-4,7-8H,1-2,5-6,9-10H2,(H2,14,18,19);1H |
| InChIKey | NKCFVZGCIWQZHO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride?
The IUPAC name of [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride (CID 19879188) is [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride.
What is the SMILES notation for [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride?
The canonical SMILES for [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride is Cl.NS(=O)(=O)CC1(COc2ccc3nccn3n2)CCCC1.
What is the InChIKey of [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride?
The InChIKey is NKCFVZGCIWQZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3S.ClH/c14-21(18,19)10-13(5-1-2-6-13)9-20-12-4-3-11-15-7-8-17(11)16-12;/h3-4,7-8H,1-2,5-6,9-10H2,(H2,14,18,19);1H.
What are the key properties of [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride?
[1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride has a molecular weight of 346.84 g/mol, XLogP of 1.38, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(imidazo[1,2-b]pyridazin-6-yloxymethyl)cyclopentyl]methanesulfonamide;hydrochloride is sourced from PubChem (CID 19879188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).