C20H27FN2 — CID 19879377
N-[2-(3-fluoro-4-phenylphenyl)propyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 19879377) has the molecular formula C20H27FN2 and a molecular weight of 314.45 g/mol. Its IUPAC name is N-[2-(3-fluoro-4-phenylphenyl)propyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-(3-fluoro-4-phenylphenyl)propyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 19879377 |
| Molecular Formula | C20H27FN2 |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | N-[2-(3-fluoro-4-phenylphenyl)propyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(CNCCCN(C)C)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C20H27FN2/c1-16(15-22-12-7-13-23(2)3)18-10-11-19(20(21)14-18)17-8-5-4-6-9-17/h4-6,8-11,14,16,22H,7,12-13,15H2,1-3H3 |
| InChIKey | LSFMSFAYPDGBTQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|