About 1,2,2-trifluoropiperidine
1,2,2-trifluoropiperidine (PubChem CID 19879593) has the molecular formula C5H8F3N
and a molecular weight of 139.12 g/mol. Its IUPAC name is 1,2,2-trifluoropiperidine.
Molecular Properties
| Compound Name | 1,2,2-trifluoropiperidine |
| PubChem CID | 19879593 |
| Molecular Formula | C5H8F3N |
| Molecular Weight | 139.12 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 1,2,2-trifluoropiperidine |
| SMILES | FN1CCCCC1(F)F |
| InChI | InChI=1S/C5H8F3N/c6-5(7)3-1-2-4-9(5)8/h1-4H2 |
| InChIKey | IJPFMKVHJGPXFQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,2,2-trifluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2-trifluoropiperidine?
The IUPAC name of 1,2,2-trifluoropiperidine (CID 19879593) is 1,2,2-trifluoropiperidine.
What is the SMILES notation for 1,2,2-trifluoropiperidine?
The canonical SMILES for 1,2,2-trifluoropiperidine is FN1CCCCC1(F)F.
What is the InChIKey of 1,2,2-trifluoropiperidine?
The InChIKey is IJPFMKVHJGPXFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3N/c6-5(7)3-1-2-4-9(5)8/h1-4H2.
What are the key properties of 1,2,2-trifluoropiperidine?
1,2,2-trifluoropiperidine has a molecular weight of 139.12 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trifluoropiperidine is sourced from PubChem (CID 19879593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).