C20H23FO2S2 — CID 19879671
methyl 2-[2-[2-(4-fluorophenyl)ethyl]phenyl]-3,3-bis(methylsulfanyl)propanoate (PubChem CID 19879671) has the molecular formula C20H23FO2S2 and a molecular weight of 378.53 g/mol. Its IUPAC name is methyl 2-[2-[2-(4-fluorophenyl)ethyl]phenyl]-3,3-bis(methylsulfanyl)propanoate.
| Compound Name | methyl 2-[2-[2-(4-fluorophenyl)ethyl]phenyl]-3,3-bis(methylsulfanyl)propanoate |
|---|---|
| PubChem CID | 19879671 |
| Molecular Formula | C20H23FO2S2 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl 2-[2-[2-(4-fluorophenyl)ethyl]phenyl]-3,3-bis(methylsulfanyl)propanoate |
| SMILES | COC(=O)C(c1ccccc1CCc1ccc(F)cc1)C(SC)SC |
| InChI | InChI=1S/C20H23FO2S2/c1-23-19(22)18(20(24-2)25-3)17-7-5-4-6-15(17)11-8-14-9-12-16(21)13-10-14/h4-7,9-10,12-13,18,20H,8,11H2,1-3H3 |
| InChIKey | ZFMFSQSSSKJTJA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|