C20H26N2 — CID 19879718
(5Z)-15-(cyclopropylmethyl)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene (PubChem CID 19879718) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (5Z)-15-(cyclopropylmethyl)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene.
| Compound Name | (5Z)-15-(cyclopropylmethyl)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
|---|---|
| PubChem CID | 19879718 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (5Z)-15-(cyclopropylmethyl)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
| SMILES | CC1C2CC3=C(CCC4=C3/C=C\C/N=C\C41C)N2CC1CC1 |
| InChI | InChI=1S/C20H26N2/c1-13-19-10-16-15-4-3-9-21-12-20(13,2)17(15)7-8-18(16)22(19)11-14-5-6-14/h3-4,12-14,19H,5-11H2,1-2H3/b4-3-,21-12- |
| InChIKey | DBXFWLWHVDAREV-NPFQSNKDSA-N |
| XLogP | 4.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |