C17H23ClN2 — CID 19879723
(5E)-6-chloro-10,15,16-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5-triene (PubChem CID 19879723) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is (5E)-6-chloro-10,15,16-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5-triene.
| Compound Name | (5E)-6-chloro-10,15,16-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5-triene |
|---|---|
| PubChem CID | 19879723 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (5E)-6-chloro-10,15,16-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5-triene |
| SMILES | CC1C2CC3=C(CCC4=C3/C=C(/Cl)CNCC41C)N2C |
| InChI | InChI=1S/C17H23ClN2/c1-10-16-7-13-12-6-11(18)8-19-9-17(10,2)14(12)4-5-15(13)20(16)3/h6,10,16,19H,4-5,7-9H2,1-3H3/b11-6+ |
| InChIKey | VIUIGGIQDDIPMC-IZZDOVSWSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |