C21H30N2 — CID 19879739
(6Z)-10,16-dimethyl-15-(3-methylbut-2-enyl)-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),6-triene (PubChem CID 19879739) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is (6Z)-10,16-dimethyl-15-(3-methylbut-2-enyl)-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),6-triene.
| Compound Name | (6Z)-10,16-dimethyl-15-(3-methylbut-2-enyl)-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),6-triene |
|---|---|
| PubChem CID | 19879739 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | (6Z)-10,16-dimethyl-15-(3-methylbut-2-enyl)-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),6-triene |
| SMILES | CC(C)=CCC1C2CC3=C4C=C2NC1C(C)C(C)(C3)NC/C=C\4 |
| InChI | InChI=1S/C21H30N2/c1-13(2)7-8-17-18-10-16-12-21(4)14(3)20(17)23-19(18)11-15(16)6-5-9-22-21/h5-7,11,14,17-18,20,22-23H,8-10,12H2,1-4H3/b6-5- |
| InChIKey | AVJWTMOVKRSQHJ-WAYWQWQTSA-N |
| XLogP | 4.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|