C17H24N2 — CID 19879742
(6Z)-10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),6-triene (PubChem CID 19879742) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (6Z)-10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),6-triene.
| Compound Name | (6Z)-10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),6-triene |
|---|---|
| PubChem CID | 19879742 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (6Z)-10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),6-triene |
| SMILES | CC1C2CC3=C4C=C2NC1C(C)C(C)(C3)NC/C=C\4 |
| InChI | InChI=1S/C17H24N2/c1-10-14-7-13-9-17(3)11(2)16(10)19-15(14)8-12(13)5-4-6-18-17/h4-5,8,10-11,14,16,18-19H,6-7,9H2,1-3H3/b5-4- |
| InChIKey | HEXKWLJBPZUPLG-PLNGDYQASA-N |
| XLogP | 2.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |