C16H20N2 — CID 19879752
(5Z)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene (PubChem CID 19879752) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (5Z)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene.
| Compound Name | (5Z)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
|---|---|
| PubChem CID | 19879752 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (5Z)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
| SMILES | CC1C2CC3=C(CCC4=C3/C=C\C/N=C\C41C)N2 |
| InChI | InChI=1S/C16H20N2/c1-10-15-8-12-11-4-3-7-17-9-16(10,2)13(11)5-6-14(12)18-15/h3-4,9-10,15,18H,5-8H2,1-2H3/b4-3-,17-9- |
| InChIKey | LOMIZXFNDSISCU-VYHZRZITSA-N |
| XLogP | 2.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |