C17H18ClN3 — CID 19879753
(5E)-6-chloro-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene-15-carbonitrile (PubChem CID 19879753) has the molecular formula C17H18ClN3 and a molecular weight of 299.81 g/mol. Its IUPAC name is (5E)-6-chloro-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene-15-carbonitrile.
| Compound Name | (5E)-6-chloro-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene-15-carbonitrile |
|---|---|
| PubChem CID | 19879753 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (5E)-6-chloro-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene-15-carbonitrile |
| SMILES | CC1C2CC3=C(CCC4=C3/C=C(/Cl)C/N=C\C41C)N2C#N |
| InChI | InChI=1S/C17H18ClN3/c1-10-16-6-13-12-5-11(18)7-20-8-17(10,2)14(12)3-4-15(13)21(16)9-19/h5,8,10,16H,3-4,6-7H2,1-2H3/b11-5+,20-8- |
| InChIKey | AHKRNCMJXIIPJE-HJGVXWESSA-N |
| XLogP | 3.75 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|