C17H19N3 — CID 19879767
(5Z)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene-15-carbonitrile (PubChem CID 19879767) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is (5Z)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene-15-carbonitrile.
| Compound Name | (5Z)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene-15-carbonitrile |
|---|---|
| PubChem CID | 19879767 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | (5Z)-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene-15-carbonitrile |
| SMILES | CC1C2CC3=C(CCC4=C3/C=C\C/N=C\C41C)N2C#N |
| InChI | InChI=1S/C17H19N3/c1-11-16-8-13-12-4-3-7-19-9-17(11,2)14(12)5-6-15(13)20(16)10-18/h3-4,9,11,16H,5-8H2,1-2H3/b4-3-,19-9- |
| InChIKey | PWWYZRIVDKRVSF-QHFPZLQISA-N |
| XLogP | 3.18 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|