C11H17N — CID 19879771
1,2,3,4,5,6,6a,10a-octahydro-1-benzazocine (PubChem CID 19879771) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 1,2,3,4,5,6,6a,10a-octahydro-1-benzazocine.
| Compound Name | 1,2,3,4,5,6,6a,10a-octahydro-1-benzazocine |
|---|---|
| PubChem CID | 19879771 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1,2,3,4,5,6,6a,10a-octahydro-1-benzazocine |
| SMILES | C1=CC2CCCCCNC2C=C1 |
| InChI | InChI=1S/C11H17N/c1-2-6-10-7-3-4-8-11(10)12-9-5-1/h3-4,7-8,10-12H,1-2,5-6,9H2 |
| InChIKey | NYMWBFSJNHWUQJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |