C21H28N2 — CID 19879774
(5Z)-10,16-dimethyl-15-(3-methylbut-2-enyl)-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene (PubChem CID 19879774) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is (5Z)-10,16-dimethyl-15-(3-methylbut-2-enyl)-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene.
| Compound Name | (5Z)-10,16-dimethyl-15-(3-methylbut-2-enyl)-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
|---|---|
| PubChem CID | 19879774 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | (5Z)-10,16-dimethyl-15-(3-methylbut-2-enyl)-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
| SMILES | CC(C)=CCN1C2=C3CC1C(C)C1(C)/C=N\C/C=C\C3=C1CC2 |
| InChI | InChI=1S/C21H28N2/c1-14(2)9-11-23-19-8-7-18-16-6-5-10-22-13-21(18,4)15(3)20(23)12-17(16)19/h5-6,9,13,15,20H,7-8,10-12H2,1-4H3/b6-5-,22-13- |
| InChIKey | UYZZLCVHMVWTQZ-VWLVJHGJSA-N |
| XLogP | 4.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|