C19H30N2 — CID 19879777
8-ethyl-10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12)-diene (PubChem CID 19879777) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 8-ethyl-10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12)-diene.
| Compound Name | 8-ethyl-10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12)-diene |
|---|---|
| PubChem CID | 19879777 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 8-ethyl-10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12)-diene |
| SMILES | CCC1CCC2=C3CC4C(=C2)NC(C4C)C(C)C(C)(C3)N1 |
| InChI | InChI=1S/C19H30N2/c1-5-15-7-6-13-9-17-16-8-14(13)10-19(4,21-15)12(3)18(20-17)11(16)2/h9,11-12,15-16,18,20-21H,5-8,10H2,1-4H3 |
| InChIKey | ROOKGVRCBBFEAN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |