C17H26N2 — CID 19879790
10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12)-diene (PubChem CID 19879790) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12)-diene.
| Compound Name | 10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12)-diene |
|---|---|
| PubChem CID | 19879790 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 10,15,16-trimethyl-2,9-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12)-diene |
| SMILES | CC1C2CC3=C4C=C2NC1C(C)C(C)(C3)NCCC4 |
| InChI | InChI=1S/C17H26N2/c1-10-14-7-13-9-17(3)11(2)16(10)19-15(14)8-12(13)5-4-6-18-17/h8,10-11,14,16,18-19H,4-7,9H2,1-3H3 |
| InChIKey | ZKTGDXMQANDIBF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |