C12H15ClN2O3 — CID 19880175
(2-chloro-3,4-dihydroxyphenyl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 19880175) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is (2-chloro-3,4-dihydroxyphenyl)-(4-methylpiperazin-1-yl)methanone.
| Compound Name | (2-chloro-3,4-dihydroxyphenyl)-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 19880175 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2-chloro-3,4-dihydroxyphenyl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(O)c(O)c2Cl)CC1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-14-4-6-15(7-5-14)12(18)8-2-3-9(16)11(17)10(8)13/h2-3,16-17H,4-7H2,1H3 |
| InChIKey | VPPNLWICNFCMNR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|