About 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol
3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol (PubChem CID 19880290) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol.
Molecular Properties
| Compound Name | 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol |
| PubChem CID | 19880290 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol |
| SMILES | CC(C)=CCCC(C)(O)CC(O)N1CCCCC1 |
| InChI | InChI=1S/C15H29NO2/c1-13(2)8-7-9-15(3,18)12-14(17)16-10-5-4-6-11-16/h8,14,17-18H,4-7,9-12H2,1-3H3 |
| InChIKey | UNWMXOJRZCMULK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol?
The IUPAC name of 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol (CID 19880290) is 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol.
What is the SMILES notation for 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol?
The canonical SMILES for 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol is CC(C)=CCCC(C)(O)CC(O)N1CCCCC1.
What is the InChIKey of 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol?
The InChIKey is UNWMXOJRZCMULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-13(2)8-7-9-15(3,18)12-14(17)16-10-5-4-6-11-16/h8,14,17-18H,4-7,9-12H2,1-3H3.
What are the key properties of 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol?
3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol has a molecular weight of 255.40 g/mol, XLogP of 2.68, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-1-piperidin-1-yloct-6-ene-1,3-diol is sourced from PubChem (CID 19880290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).