C24H32N2O5 — CID 19880443
N,N-dimethylaniline;4-[2-(3,4,5-trimethoxyphenyl)-1,3-dioxolan-2-yl]butanenitrile (PubChem CID 19880443) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is N,N-dimethylaniline;4-[2-(3,4,5-trimethoxyphenyl)-1,3-dioxolan-2-yl]butanenitrile.
| Compound Name | N,N-dimethylaniline;4-[2-(3,4,5-trimethoxyphenyl)-1,3-dioxolan-2-yl]butanenitrile |
|---|---|
| PubChem CID | 19880443 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N,N-dimethylaniline;4-[2-(3,4,5-trimethoxyphenyl)-1,3-dioxolan-2-yl]butanenitrile |
| SMILES | CN(C)c1ccccc1.COc1cc(C2(CCCC#N)OCCO2)cc(OC)c1OC |
| InChI | InChI=1S/C16H21NO5.C8H11N/c1-18-13-10-12(11-14(19-2)15(13)20-3)16(6-4-5-7-17)21-8-9-22-16;1-9(2)8-6-4-3-5-7-8/h10-11H,4-6,8-9H2,1-3H3;3-7H,1-2H3 |
| InChIKey | UXDJMJHAAROSLZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 73.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|