About 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate
2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate (PubChem CID 19880621) has the molecular formula C14H21NO7
and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate.
Molecular Properties
| Compound Name | 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate |
| PubChem CID | 19880621 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H21NO7/c1-2-19-11-14(18)22-10-9-21-8-7-20-6-5-15-12(16)3-4-13(15)17/h3-4H,2,5-11H2,1H3 |
| InChIKey | DLQYYTPHXPQLTQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate?
The IUPAC name of 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate (CID 19880621) is 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate.
What is the SMILES notation for 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate?
The canonical SMILES for 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate is CCOCC(=O)OCCOCCOCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate?
The InChIKey is DLQYYTPHXPQLTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO7/c1-2-19-11-14(18)22-10-9-21-8-7-20-6-5-15-12(16)3-4-13(15)17/h3-4H,2,5-11H2,1H3.
What are the key properties of 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate?
2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate has a molecular weight of 315.32 g/mol, XLogP of -0.48, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl 2-ethoxyacetate is sourced from PubChem (CID 19880621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).