C21H38 — CID 19880755
1,2,3,4-tetratert-butylcyclopenta-1,3-diene (PubChem CID 19880755) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is 1,2,3,4-tetratert-butylcyclopenta-1,3-diene.
| Compound Name | 1,2,3,4-tetratert-butylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 19880755 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 1,2,3,4-tetratert-butylcyclopenta-1,3-diene |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C21H38/c1-18(2,3)14-13-15(19(4,5)6)17(21(10,11)12)16(14)20(7,8)9/h13H2,1-12H3 |
| InChIKey | WAROELGYRGCNOJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |