About 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate
2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate (PubChem CID 19880783) has the molecular formula C12H8Cl3NO2S2
and a molecular weight of 368.69 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate |
| PubChem CID | 19880783 |
| Molecular Formula | C12H8Cl3NO2S2 |
| Molecular Weight | 368.69 g/mol |
| Exact Mass | 366.91 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate |
| SMILES | O=C(OCCSc1ccc(Cl)cc1)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl3NO2S2/c13-7-1-3-8(4-2-7)19-6-5-18-12(17)10-9(14)11(15)16-20-10/h1-4H,5-6H2 |
| InChIKey | RUIZPYVMHMIQDV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate?
The IUPAC name of 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate (CID 19880783) is 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate.
What is the SMILES notation for 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate?
The canonical SMILES for 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate is O=C(OCCSc1ccc(Cl)cc1)c1snc(Cl)c1Cl.
What is the InChIKey of 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate?
The InChIKey is RUIZPYVMHMIQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl3NO2S2/c13-7-1-3-8(4-2-7)19-6-5-18-12(17)10-9(14)11(15)16-20-10/h1-4H,5-6H2.
What are the key properties of 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate?
2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate has a molecular weight of 368.69 g/mol, XLogP of 5.05, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)sulfanylethyl 3,4-dichloro-1,2-thiazole-5-carboxylate is sourced from PubChem (CID 19880783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).