About 2-(2,3-ditert-butylphenyl)phenol
2-(2,3-ditert-butylphenyl)phenol (PubChem CID 19881409) has the molecular formula C20H26O
and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-(2,3-ditert-butylphenyl)phenol.
Molecular Properties
| Compound Name | 2-(2,3-ditert-butylphenyl)phenol |
| PubChem CID | 19881409 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 2-(2,3-ditert-butylphenyl)phenol |
| SMILES | CC(C)(C)c1cccc(-c2ccccc2O)c1C(C)(C)C |
| InChI | InChI=1S/C20H26O/c1-19(2,3)16-12-9-11-15(18(16)20(4,5)6)14-10-7-8-13-17(14)21/h7-13,21H,1-6H3 |
| InChIKey | NNAKPCNFMLEKHI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,3-ditert-butylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-ditert-butylphenyl)phenol?
The IUPAC name of 2-(2,3-ditert-butylphenyl)phenol (CID 19881409) is 2-(2,3-ditert-butylphenyl)phenol.
What is the SMILES notation for 2-(2,3-ditert-butylphenyl)phenol?
The canonical SMILES for 2-(2,3-ditert-butylphenyl)phenol is CC(C)(C)c1cccc(-c2ccccc2O)c1C(C)(C)C.
What is the InChIKey of 2-(2,3-ditert-butylphenyl)phenol?
The InChIKey is NNAKPCNFMLEKHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O/c1-19(2,3)16-12-9-11-15(18(16)20(4,5)6)14-10-7-8-13-17(14)21/h7-13,21H,1-6H3.
What are the key properties of 2-(2,3-ditert-butylphenyl)phenol?
2-(2,3-ditert-butylphenyl)phenol has a molecular weight of 282.43 g/mol, XLogP of 5.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-ditert-butylphenyl)phenol is sourced from PubChem (CID 19881409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).