About 1-methyl-3H-azepin-2-one
1-methyl-3H-azepin-2-one (PubChem CID 19881567) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 1-methyl-3H-azepin-2-one.
Molecular Properties
| Compound Name | 1-methyl-3H-azepin-2-one |
| PubChem CID | 19881567 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 1-methyl-3H-azepin-2-one |
| SMILES | CN1C=CC=CCC1=O |
| InChI | InChI=1S/C7H9NO/c1-8-6-4-2-3-5-7(8)9/h2-4,6H,5H2,1H3 |
| InChIKey | HFQGPJZLZGVGET-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-3H-azepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3H-azepin-2-one?
The IUPAC name of 1-methyl-3H-azepin-2-one (CID 19881567) is 1-methyl-3H-azepin-2-one.
What is the SMILES notation for 1-methyl-3H-azepin-2-one?
The canonical SMILES for 1-methyl-3H-azepin-2-one is CN1C=CC=CCC1=O.
What is the InChIKey of 1-methyl-3H-azepin-2-one?
The InChIKey is HFQGPJZLZGVGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-8-6-4-2-3-5-7(8)9/h2-4,6H,5H2,1H3.
What are the key properties of 1-methyl-3H-azepin-2-one?
1-methyl-3H-azepin-2-one has a molecular weight of 123.15 g/mol, XLogP of 0.92, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3H-azepin-2-one is sourced from PubChem (CID 19881567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).