C9H16N2 — CID 19881641
2,3,4,4a,5,6,7,9a-octahydro-1H-pyrido[3,2-b]azepine (PubChem CID 19881641) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,9a-octahydro-1H-pyrido[3,2-b]azepine.
| Compound Name | 2,3,4,4a,5,6,7,9a-octahydro-1H-pyrido[3,2-b]azepine |
|---|---|
| PubChem CID | 19881641 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2,3,4,4a,5,6,7,9a-octahydro-1H-pyrido[3,2-b]azepine |
| SMILES | C1=CC2NCCCC2NCC1 |
| InChI | InChI=1S/C9H16N2/c1-2-6-10-9-5-3-7-11-8(9)4-1/h1,4,8-11H,2-3,5-7H2 |
| InChIKey | FNZLLQYTLUWTSR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|