About 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one
2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one (PubChem CID 19881969) has the molecular formula C16H24N2O4
and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one |
| PubChem CID | 19881969 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one |
| SMILES | O=C1CN=C(CCCCCCCCCCC2=NCC(=O)O2)O1 |
| InChI | InChI=1S/C16H24N2O4/c19-15-11-17-13(21-15)9-7-5-3-1-2-4-6-8-10-14-18-12-16(20)22-14/h1-12H2 |
| InChIKey | DFAWQYROSGGZCU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one?
The IUPAC name of 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one (CID 19881969) is 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one.
What is the SMILES notation for 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one?
The canonical SMILES for 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one is O=C1CN=C(CCCCCCCCCCC2=NCC(=O)O2)O1.
What is the InChIKey of 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one?
The InChIKey is DFAWQYROSGGZCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O4/c19-15-11-17-13(21-15)9-7-5-3-1-2-4-6-8-10-14-18-12-16(20)22-14/h1-12H2.
What are the key properties of 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one?
2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one has a molecular weight of 308.38 g/mol, XLogP of 2.80, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[10-(5-oxo-4H-1,3-oxazol-2-yl)decyl]-4H-1,3-oxazol-5-one is sourced from PubChem (CID 19881969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).