About 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide
1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide (PubChem CID 19882725) has the molecular formula C6H21Br2N5O
and a molecular weight of 339.08 g/mol. Its IUPAC name is 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide.
Molecular Properties
| Compound Name | 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide |
| PubChem CID | 19882725 |
| Molecular Formula | C6H21Br2N5O |
| Molecular Weight | 339.08 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide |
| SMILES | Br.Br.CN(C)CCC/N=C(\N)NN.O |
| InChI | InChI=1S/C6H17N5.2BrH.H2O/c1-11(2)5-3-4-9-6(7)10-8;;;/h3-5,8H2,1-2H3,(H3,7,9,10);2*1H;1H2 |
| InChIKey | WGDIOUAKIMRWJR-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.08 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide?
The IUPAC name of 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide (CID 19882725) is 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide.
What is the SMILES notation for 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide?
The canonical SMILES for 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide is Br.Br.CN(C)CCC/N=C(\N)NN.O.
What is the InChIKey of 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide?
The InChIKey is WGDIOUAKIMRWJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17N5.2BrH.H2O/c1-11(2)5-3-4-9-6(7)10-8;;;/h3-5,8H2,1-2H3,(H3,7,9,10);2*1H;1H2.
What are the key properties of 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide?
1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide has a molecular weight of 339.08 g/mol, XLogP of -0.95, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-[3-(dimethylamino)propyl]guanidine;hydrate;dihydrobromide is sourced from PubChem (CID 19882725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).