About pyrazolo[1,5-a]pyrimidine-6-carboxylic acid
pyrazolo[1,5-a]pyrimidine-6-carboxylic acid (PubChem CID 19883261) has the molecular formula C7H5N3O2
and a molecular weight of 163.14 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyrimidine-6-carboxylic acid.
Molecular Properties
| Compound Name | pyrazolo[1,5-a]pyrimidine-6-carboxylic acid |
| PubChem CID | 19883261 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | pyrazolo[1,5-a]pyrimidine-6-carboxylic acid |
| SMILES | O=C(O)c1cnc2ccnn2c1 |
| InChI | InChI=1S/C7H5N3O2/c11-7(12)5-3-8-6-1-2-9-10(6)4-5/h1-4H,(H,11,12) |
| InChIKey | GDASVOXREDJRGF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrazolo[1,5-a]pyrimidine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[1,5-a]pyrimidine-6-carboxylic acid?
The IUPAC name of pyrazolo[1,5-a]pyrimidine-6-carboxylic acid (CID 19883261) is pyrazolo[1,5-a]pyrimidine-6-carboxylic acid.
What is the SMILES notation for pyrazolo[1,5-a]pyrimidine-6-carboxylic acid?
The canonical SMILES for pyrazolo[1,5-a]pyrimidine-6-carboxylic acid is O=C(O)c1cnc2ccnn2c1.
What is the InChIKey of pyrazolo[1,5-a]pyrimidine-6-carboxylic acid?
The InChIKey is GDASVOXREDJRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c11-7(12)5-3-8-6-1-2-9-10(6)4-5/h1-4H,(H,11,12).
What are the key properties of pyrazolo[1,5-a]pyrimidine-6-carboxylic acid?
pyrazolo[1,5-a]pyrimidine-6-carboxylic acid has a molecular weight of 163.14 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[1,5-a]pyrimidine-6-carboxylic acid is sourced from PubChem (CID 19883261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).