About 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane
9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane (PubChem CID 19883280) has the molecular formula C7H12FNO2
and a molecular weight of 161.18 g/mol. Its IUPAC name is 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane |
| PubChem CID | 19883280 |
| Molecular Formula | C7H12FNO2 |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane |
| SMILES | FCC1CNCC12OCCO2 |
| InChI | InChI=1S/C7H12FNO2/c8-3-6-4-9-5-7(6)10-1-2-11-7/h6,9H,1-5H2 |
| InChIKey | ZRJFMEPDICYKGY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane?
The IUPAC name of 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane (CID 19883280) is 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane.
What is the SMILES notation for 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane?
The canonical SMILES for 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane is FCC1CNCC12OCCO2.
What is the InChIKey of 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane?
The InChIKey is ZRJFMEPDICYKGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FNO2/c8-3-6-4-9-5-7(6)10-1-2-11-7/h6,9H,1-5H2.
What are the key properties of 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane?
9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane has a molecular weight of 161.18 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(fluoromethyl)-1,4-dioxa-7-azaspiro[4.4]nonane is sourced from PubChem (CID 19883280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).