About 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane
3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 19883302) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane |
| PubChem CID | 19883302 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CCC1COC2(CCNCC2)O1 |
| InChI | InChI=1S/C9H17NO2/c1-2-8-7-11-9(12-8)3-5-10-6-4-9/h8,10H,2-7H2,1H3 |
| InChIKey | NUVGKWXXLCDUAW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane?
The IUPAC name of 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane (CID 19883302) is 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane.
What is the SMILES notation for 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane?
The canonical SMILES for 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane is CCC1COC2(CCNCC2)O1.
What is the InChIKey of 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane?
The InChIKey is NUVGKWXXLCDUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-2-8-7-11-9(12-8)3-5-10-6-4-9/h8,10H,2-7H2,1H3.
What are the key properties of 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane?
3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane has a molecular weight of 171.24 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,4-dioxa-8-azaspiro[4.5]decane is sourced from PubChem (CID 19883302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).