About 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine
9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine (PubChem CID 19883305) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine.
Molecular Properties
| Compound Name | 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine |
| PubChem CID | 19883305 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine |
| SMILES | CC1OC2(CCNC2)OCC1N |
| InChI | InChI=1S/C8H16N2O2/c1-6-7(9)4-11-8(12-6)2-3-10-5-8/h6-7,10H,2-5,9H2,1H3 |
| InChIKey | BQHUSLNUTJWRAM-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine?
The IUPAC name of 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine (CID 19883305) is 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine.
What is the SMILES notation for 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine?
The canonical SMILES for 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine is CC1OC2(CCNC2)OCC1N.
What is the InChIKey of 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine?
The InChIKey is BQHUSLNUTJWRAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-6-7(9)4-11-8(12-6)2-3-10-5-8/h6-7,10H,2-5,9H2,1H3.
What are the key properties of 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine?
9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine has a molecular weight of 172.23 g/mol, XLogP of -0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-6,10-dioxa-2-azaspiro[4.5]decan-8-amine is sourced from PubChem (CID 19883305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).