About 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane
4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane (PubChem CID 19883460) has the molecular formula C16H13ClF2O2
and a molecular weight of 310.73 g/mol. Its IUPAC name is 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane |
| PubChem CID | 19883460 |
| Molecular Formula | C16H13ClF2O2 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane |
| SMILES | Fc1ccc(C2(c3ccc(F)cc3)OCC(CCl)O2)cc1 |
| InChI | InChI=1S/C16H13ClF2O2/c17-9-15-10-20-16(21-15,11-1-5-13(18)6-2-11)12-3-7-14(19)8-4-12/h1-8,15H,9-10H2 |
| InChIKey | DMYMMJJUFRJLNS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane?
The IUPAC name of 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane (CID 19883460) is 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane.
What is the SMILES notation for 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane?
The canonical SMILES for 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane is Fc1ccc(C2(c3ccc(F)cc3)OCC(CCl)O2)cc1.
What is the InChIKey of 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane?
The InChIKey is DMYMMJJUFRJLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF2O2/c17-9-15-10-20-16(21-15,11-1-5-13(18)6-2-11)12-3-7-14(19)8-4-12/h1-8,15H,9-10H2.
What are the key properties of 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane?
4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane has a molecular weight of 310.73 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2,2-bis(4-fluorophenyl)-1,3-dioxolane is sourced from PubChem (CID 19883460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).