About 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane
4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane (PubChem CID 19883614) has the molecular formula C23H24O2S
and a molecular weight of 364.51 g/mol. Its IUPAC name is 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane |
| PubChem CID | 19883614 |
| Molecular Formula | C23H24O2S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane |
| SMILES | CCC1(c2cccc(Sc3ccc4ccccc4c3)c2)COC(C)(C)O1 |
| InChI | InChI=1S/C23H24O2S/c1-4-23(16-24-22(2,3)25-23)19-10-7-11-20(15-19)26-21-13-12-17-8-5-6-9-18(17)14-21/h5-15H,4,16H2,1-3H3 |
| InChIKey | UVWITSXRIVCLPT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane?
The IUPAC name of 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane (CID 19883614) is 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane.
What is the SMILES notation for 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane?
The canonical SMILES for 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane is CCC1(c2cccc(Sc3ccc4ccccc4c3)c2)COC(C)(C)O1.
What is the InChIKey of 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane?
The InChIKey is UVWITSXRIVCLPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O2S/c1-4-23(16-24-22(2,3)25-23)19-10-7-11-20(15-19)26-21-13-12-17-8-5-6-9-18(17)14-21/h5-15H,4,16H2,1-3H3.
What are the key properties of 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane?
4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane has a molecular weight of 364.51 g/mol, XLogP of 6.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,2-dimethyl-4-(3-naphthalen-2-ylsulfanylphenyl)-1,3-dioxolane is sourced from PubChem (CID 19883614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).