C14H24N2O4 — CID 19883852
methyl N-[1-(methoxycarbonylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]carbamate (PubChem CID 19883852) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is methyl N-[1-(methoxycarbonylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]carbamate.
| Compound Name | methyl N-[1-(methoxycarbonylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 19883852 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | methyl N-[1-(methoxycarbonylamino)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]carbamate |
| SMILES | COC(=O)NC1(NC(=O)OC)CCCC2CCCCC21 |
| InChI | InChI=1S/C14H24N2O4/c1-19-12(17)15-14(16-13(18)20-2)9-5-7-10-6-3-4-8-11(10)14/h10-11H,3-9H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | PYINHIQINPMCOZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|