About 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate
2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (PubChem CID 19884574) has the molecular formula C11H8ClF3N2O2S2
and a molecular weight of 356.78 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| PubChem CID | 19884574 |
| Molecular Formula | C11H8ClF3N2O2S2 |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ncsc1CCOC(=O)c1sc(Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C11H8ClF3N2O2S2/c1-5-6(20-4-16-5)2-3-19-9(18)7-8(11(13,14)15)17-10(12)21-7/h4H,2-3H2,1H3 |
| InChIKey | VAVAOPWJJSYAQC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
The IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CID 19884574) is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate is Cc1ncsc1CCOC(=O)c1sc(Cl)nc1C(F)(F)F.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
The InChIKey is VAVAOPWJJSYAQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClF3N2O2S2/c1-5-6(20-4-16-5)2-3-19-9(18)7-8(11(13,14)15)17-10(12)21-7/h4H,2-3H2,1H3.
What are the key properties of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate?
2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate has a molecular weight of 356.78 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 19884574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).