About 3-methyl-4-oxobutanoic acid
3-methyl-4-oxobutanoic acid (PubChem CID 19884862) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is 3-methyl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 3-methyl-4-oxobutanoic acid |
| PubChem CID | 19884862 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | 3-methyl-4-oxobutanoic acid |
| SMILES | CC(C=O)CC(=O)O |
| InChI | InChI=1S/C5H8O3/c1-4(3-6)2-5(7)8/h3-4H,2H2,1H3,(H,7,8) |
| InChIKey | NJUSKFMQOHRMIP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-oxobutanoic acid?
The IUPAC name of 3-methyl-4-oxobutanoic acid (CID 19884862) is 3-methyl-4-oxobutanoic acid.
What is the SMILES notation for 3-methyl-4-oxobutanoic acid?
The canonical SMILES for 3-methyl-4-oxobutanoic acid is CC(C=O)CC(=O)O.
What is the InChIKey of 3-methyl-4-oxobutanoic acid?
The InChIKey is NJUSKFMQOHRMIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c1-4(3-6)2-5(7)8/h3-4H,2H2,1H3,(H,7,8).
What are the key properties of 3-methyl-4-oxobutanoic acid?
3-methyl-4-oxobutanoic acid has a molecular weight of 116.12 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-oxobutanoic acid is sourced from PubChem (CID 19884862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).