C13H23NO — CID 19885335
1-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-en-1-one (PubChem CID 19885335) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-en-1-one.
| Compound Name | 1-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19885335 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C13H23NO/c1-7-11(15)10-8-12(2,3)14(6)13(4,5)9-10/h7,10H,1,8-9H2,2-6H3 |
| InChIKey | UUNGCMNJSIFGKX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|