About 1-(propylamino)ethanol
1-(propylamino)ethanol (PubChem CID 19885411) has the molecular formula C5H13NO
and a molecular weight of 103.16 g/mol. Its IUPAC name is 1-(propylamino)ethanol.
Molecular Properties
| Compound Name | 1-(propylamino)ethanol |
| PubChem CID | 19885411 |
| Molecular Formula | C5H13NO |
| Molecular Weight | 103.16 g/mol |
| Exact Mass | 103.10 |
| IUPAC Name | 1-(propylamino)ethanol |
| SMILES | CCCNC(C)O |
| InChI | InChI=1S/C5H13NO/c1-3-4-6-5(2)7/h5-7H,3-4H2,1-2H3 |
| InChIKey | YLLVPHVZPCGVQN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(propylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(propylamino)ethanol?
The IUPAC name of 1-(propylamino)ethanol (CID 19885411) is 1-(propylamino)ethanol.
What is the SMILES notation for 1-(propylamino)ethanol?
The canonical SMILES for 1-(propylamino)ethanol is CCCNC(C)O.
What is the InChIKey of 1-(propylamino)ethanol?
The InChIKey is YLLVPHVZPCGVQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO/c1-3-4-6-5(2)7/h5-7H,3-4H2,1-2H3.
What are the key properties of 1-(propylamino)ethanol?
1-(propylamino)ethanol has a molecular weight of 103.16 g/mol, XLogP of 0.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(propylamino)ethanol is sourced from PubChem (CID 19885411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).