4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid

C9H13NO2S — CID 19885474

IUPAC4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid
SMILESCCC(C)c1nc(C)sc1C(=O)O
InChIInChI=1S/C9H13NO2S/c1-4-5(2)7-8(9(11)12)13-6(3)10-7/h5H,4H2,1-3H3,(H,11,12)
InChIKeyDFLCXSSNHFEXNY-UHFFFAOYSA-N
MW199.27 g/mol
LogP2.66
Rot. Bonds3

About 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid

4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 19885474) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid
PubChem CID19885474
Molecular FormulaC9H13NO2S
Molecular Weight199.27 g/mol
Exact Mass199.07
IUPAC Name4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid
SMILESCCC(C)c1nc(C)sc1C(=O)O
InChIInChI=1S/C9H13NO2S/c1-4-5(2)7-8(9(11)12)13-6(3)10-7/h5H,4H2,1-3H3,(H,11,12)
InChIKeyDFLCXSSNHFEXNY-UHFFFAOYSA-N
XLogP2.66
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.27
LogP ≤ 52.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid (CID 19885474) is 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid is CCC(C)c1nc(C)sc1C(=O)O.
What is the InChIKey of 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is DFLCXSSNHFEXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-4-5(2)7-8(9(11)12)13-6(3)10-7/h5H,4H2,1-3H3,(H,11,12).
What are the key properties of 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid?
4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 199.27 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 19885474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).