About 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid
4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 19885474) has the molecular formula C9H13NO2S
and a molecular weight of 199.27 g/mol. Its IUPAC name is 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 19885474 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCC(C)c1nc(C)sc1C(=O)O |
| InChI | InChI=1S/C9H13NO2S/c1-4-5(2)7-8(9(11)12)13-6(3)10-7/h5H,4H2,1-3H3,(H,11,12) |
| InChIKey | DFLCXSSNHFEXNY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid (CID 19885474) is 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid is CCC(C)c1nc(C)sc1C(=O)O.
What is the InChIKey of 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is DFLCXSSNHFEXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-4-5(2)7-8(9(11)12)13-6(3)10-7/h5H,4H2,1-3H3,(H,11,12).
What are the key properties of 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid?
4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 199.27 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-2-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 19885474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).