About 2,4-dihexyl-1,3-thiazole-5-carboxylic acid
2,4-dihexyl-1,3-thiazole-5-carboxylic acid (PubChem CID 19885477) has the molecular formula C16H27NO2S
and a molecular weight of 297.46 g/mol. Its IUPAC name is 2,4-dihexyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2,4-dihexyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 19885477 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2,4-dihexyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCCCc1nc(CCCCCC)c(C(=O)O)s1 |
| InChI | InChI=1S/C16H27NO2S/c1-3-5-7-9-11-13-15(16(18)19)20-14(17-13)12-10-8-6-4-2/h3-12H2,1-2H3,(H,18,19) |
| InChIKey | FORVISFLNNZHAO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihexyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihexyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2,4-dihexyl-1,3-thiazole-5-carboxylic acid (CID 19885477) is 2,4-dihexyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2,4-dihexyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2,4-dihexyl-1,3-thiazole-5-carboxylic acid is CCCCCCc1nc(CCCCCC)c(C(=O)O)s1.
What is the InChIKey of 2,4-dihexyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is FORVISFLNNZHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2S/c1-3-5-7-9-11-13-15(16(18)19)20-14(17-13)12-10-8-6-4-2/h3-12H2,1-2H3,(H,18,19).
What are the key properties of 2,4-dihexyl-1,3-thiazole-5-carboxylic acid?
2,4-dihexyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 297.46 g/mol, XLogP of 5.09, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihexyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 19885477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).