4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid

C8H10FNO2S — CID 19885482

IUPAC4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid
SMILESCCCCc1nc(F)sc1C(=O)O
InChIInChI=1S/C8H10FNO2S/c1-2-3-4-5-6(7(11)12)13-8(9)10-5/h2-4H2,1H3,(H,11,12)
InChIKeyIWYOGOFGDDYUBV-UHFFFAOYSA-N
MW203.24 g/mol
LogP2.32
Rot. Bonds4

About 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid

4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid (PubChem CID 19885482) has the molecular formula C8H10FNO2S and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid
PubChem CID19885482
Molecular FormulaC8H10FNO2S
Molecular Weight203.24 g/mol
Exact Mass203.04
IUPAC Name4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid
SMILESCCCCc1nc(F)sc1C(=O)O
InChIInChI=1S/C8H10FNO2S/c1-2-3-4-5-6(7(11)12)13-8(9)10-5/h2-4H2,1H3,(H,11,12)
InChIKeyIWYOGOFGDDYUBV-UHFFFAOYSA-N
XLogP2.32
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 52.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid (CID 19885482) is 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid is CCCCc1nc(F)sc1C(=O)O.
What is the InChIKey of 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid?
The InChIKey is IWYOGOFGDDYUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO2S/c1-2-3-4-5-6(7(11)12)13-8(9)10-5/h2-4H2,1H3,(H,11,12).
What are the key properties of 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid?
4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid has a molecular weight of 203.24 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-fluoro-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 19885482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).