4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid

C6H6FNO2S — CID 19885517

IUPAC4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid
SMILESCCc1nc(F)sc1C(=O)O
InChIInChI=1S/C6H6FNO2S/c1-2-3-4(5(9)10)11-6(7)8-3/h2H2,1H3,(H,9,10)
InChIKeyHMOJZIOUGUMKJK-UHFFFAOYSA-N
MW175.18 g/mol
LogP1.54
Rot. Bonds2

About 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid

4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid (PubChem CID 19885517) has the molecular formula C6H6FNO2S and a molecular weight of 175.18 g/mol. Its IUPAC name is 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid
PubChem CID19885517
Molecular FormulaC6H6FNO2S
Molecular Weight175.18 g/mol
Exact Mass175.01
IUPAC Name4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid
SMILESCCc1nc(F)sc1C(=O)O
InChIInChI=1S/C6H6FNO2S/c1-2-3-4(5(9)10)11-6(7)8-3/h2H2,1H3,(H,9,10)
InChIKeyHMOJZIOUGUMKJK-UHFFFAOYSA-N
XLogP1.54
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.18
LogP ≤ 51.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid (CID 19885517) is 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid is CCc1nc(F)sc1C(=O)O.
What is the InChIKey of 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid?
The InChIKey is HMOJZIOUGUMKJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO2S/c1-2-3-4(5(9)10)11-6(7)8-3/h2H2,1H3,(H,9,10).
What are the key properties of 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid?
4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid has a molecular weight of 175.18 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-fluoro-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 19885517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).