About 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid
4-(bromomethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 19885539) has the molecular formula C5H4BrNO2S
and a molecular weight of 222.06 g/mol. Its IUPAC name is 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 19885539 |
| Molecular Formula | C5H4BrNO2S |
| Molecular Weight | 222.06 g/mol |
| Exact Mass | 220.91 |
| IUPAC Name | 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1scnc1CBr |
| InChI | InChI=1S/C5H4BrNO2S/c6-1-3-4(5(8)9)10-2-7-3/h2H,1H2,(H,8,9) |
| InChIKey | LGPKUOAKEXUGTJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.06 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid (CID 19885539) is 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1scnc1CBr.
What is the InChIKey of 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is LGPKUOAKEXUGTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrNO2S/c6-1-3-4(5(8)9)10-2-7-3/h2H,1H2,(H,8,9).
What are the key properties of 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid?
4-(bromomethyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 222.06 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 19885539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).