4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid

C11H17NO2S — CID 19885543

IUPAC4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid
SMILESCCCCc1nc(C(C)C)sc1C(=O)O
InChIInChI=1S/C11H17NO2S/c1-4-5-6-8-9(11(13)14)15-10(12-8)7(2)3/h7H,4-6H2,1-3H3,(H,13,14)
InChIKeySGAJGEURUALFMN-UHFFFAOYSA-N
MW227.33 g/mol
LogP3.31
Rot. Bonds5

About 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid

4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 19885543) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid
PubChem CID19885543
Molecular FormulaC11H17NO2S
Molecular Weight227.33 g/mol
Exact Mass227.10
IUPAC Name4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid
SMILESCCCCc1nc(C(C)C)sc1C(=O)O
InChIInChI=1S/C11H17NO2S/c1-4-5-6-8-9(11(13)14)15-10(12-8)7(2)3/h7H,4-6H2,1-3H3,(H,13,14)
InChIKeySGAJGEURUALFMN-UHFFFAOYSA-N
XLogP3.31
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.33
LogP ≤ 53.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid (CID 19885543) is 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid is CCCCc1nc(C(C)C)sc1C(=O)O.
What is the InChIKey of 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid?
The InChIKey is SGAJGEURUALFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-4-5-6-8-9(11(13)14)15-10(12-8)7(2)3/h7H,4-6H2,1-3H3,(H,13,14).
What are the key properties of 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid?
4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid has a molecular weight of 227.33 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 19885543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).