About tris-decoxy phosphite
tris-decoxy phosphite (PubChem CID 19885773) has the molecular formula C30H63O6P
and a molecular weight of 550.80 g/mol. Its IUPAC name is tris-decoxy phosphite.
Molecular Properties
| Compound Name | tris-decoxy phosphite |
| PubChem CID | 19885773 |
| Molecular Formula | C30H63O6P |
| Molecular Weight | 550.80 g/mol |
| Exact Mass | 550.44 |
| IUPAC Name | tris-decoxy phosphite |
| SMILES | CCCCCCCCCCOOP(OOCCCCCCCCCC)OOCCCCCCCCCC |
| InChI | InChI=1S/C30H63O6P/c1-4-7-10-13-16-19-22-25-28-31-34-37(35-32-29-26-23-20-17-14-11-8-5-2)36-33-30-27-24-21-18-15-12-9-6-3/h4-30H2,1-3H3 |
| InChIKey | BJJATEHGGYUECY-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.80 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris-decoxy phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris-decoxy phosphite?
The IUPAC name of tris-decoxy phosphite (CID 19885773) is tris-decoxy phosphite.
What is the SMILES notation for tris-decoxy phosphite?
The canonical SMILES for tris-decoxy phosphite is CCCCCCCCCCOOP(OOCCCCCCCCCC)OOCCCCCCCCCC.
What is the InChIKey of tris-decoxy phosphite?
The InChIKey is BJJATEHGGYUECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H63O6P/c1-4-7-10-13-16-19-22-25-28-31-34-37(35-32-29-26-23-20-17-14-11-8-5-2)36-33-30-27-24-21-18-15-12-9-6-3/h4-30H2,1-3H3.
What are the key properties of tris-decoxy phosphite?
tris-decoxy phosphite has a molecular weight of 550.80 g/mol, XLogP of 11.48, 33 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris-decoxy phosphite is sourced from PubChem (CID 19885773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).