C12H16N2O2 — CID 19886076
N'-[(7-methoxy-1-benzofuran-2-yl)methyl]ethane-1,2-diamine (PubChem CID 19886076) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N'-[(7-methoxy-1-benzofuran-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(7-methoxy-1-benzofuran-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 19886076 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N'-[(7-methoxy-1-benzofuran-2-yl)methyl]ethane-1,2-diamine |
| SMILES | COc1cccc2cc(CNCCN)oc12 |
| InChI | InChI=1S/C12H16N2O2/c1-15-11-4-2-3-9-7-10(16-12(9)11)8-14-6-5-13/h2-4,7,14H,5-6,8,13H2,1H3 |
| InChIKey | GSQLGEWHWLZDKA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|