C17H16FN3O4S2 — CID 19886265
N-[1-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanesulfonamide (PubChem CID 19886265) has the molecular formula C17H16FN3O4S2 and a molecular weight of 409.46 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanesulfonamide.
| Compound Name | N-[1-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 19886265 |
| Molecular Formula | C17H16FN3O4S2 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-[1-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyrazol-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(-c2ccc(S(C)(=O)=O)cc2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H16FN3O4S2/c1-26(22,23)15-9-3-12(4-10-15)16-11-17(20-27(2,24)25)19-21(16)14-7-5-13(18)6-8-14/h3-11H,1-2H3,(H,19,20) |
| InChIKey | GXYIPWUZFOGNCW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |