About 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol
2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol (PubChem CID 19886603) has the molecular formula C22H12Cl4O4
and a molecular weight of 482.15 g/mol. Its IUPAC name is 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol.
Molecular Properties
| Compound Name | 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol |
| PubChem CID | 19886603 |
| Molecular Formula | C22H12Cl4O4 |
| Molecular Weight | 482.15 g/mol |
| Exact Mass | 479.95 |
| IUPAC Name | 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol |
| SMILES | Oc1c(Oc2ccc(Cl)cc2Cl)c(Oc2ccc(Cl)cc2Cl)c(O)c2ccccc12 |
| InChI | InChI=1S/C22H12Cl4O4/c23-11-5-7-17(15(25)9-11)29-21-19(27)13-3-1-2-4-14(13)20(28)22(21)30-18-8-6-12(24)10-16(18)26/h1-10,27-28H |
| InChIKey | HLOARZUSGMSLGG-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.15 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol?
The IUPAC name of 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol (CID 19886603) is 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol.
What is the SMILES notation for 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol?
The canonical SMILES for 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol is Oc1c(Oc2ccc(Cl)cc2Cl)c(Oc2ccc(Cl)cc2Cl)c(O)c2ccccc12.
What is the InChIKey of 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol?
The InChIKey is HLOARZUSGMSLGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12Cl4O4/c23-11-5-7-17(15(25)9-11)29-21-19(27)13-3-1-2-4-14(13)20(28)22(21)30-18-8-6-12(24)10-16(18)26/h1-10,27-28H.
What are the key properties of 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol?
2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol has a molecular weight of 482.15 g/mol, XLogP of 8.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(2,4-dichlorophenoxy)naphthalene-1,4-diol is sourced from PubChem (CID 19886603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).