About 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione
2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione (PubChem CID 19887397) has the molecular formula C16H15BrN2O2
and a molecular weight of 347.21 g/mol. Its IUPAC name is 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione |
| PubChem CID | 19887397 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione |
| SMILES | CC1(C)C=C(n2[nH]c(=O)ccc2=O)c2cc(Br)ccc2C1 |
| InChI | InChI=1S/C16H15BrN2O2/c1-16(2)8-10-3-4-11(17)7-12(10)13(9-16)19-15(21)6-5-14(20)18-19/h3-7,9H,8H2,1-2H3,(H,18,20) |
| InChIKey | GHTHXLQIEONGIA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione?
The IUPAC name of 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione (CID 19887397) is 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione.
What is the SMILES notation for 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione?
The canonical SMILES for 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione is CC1(C)C=C(n2[nH]c(=O)ccc2=O)c2cc(Br)ccc2C1.
What is the InChIKey of 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione?
The InChIKey is GHTHXLQIEONGIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrN2O2/c1-16(2)8-10-3-4-11(17)7-12(10)13(9-16)19-15(21)6-5-14(20)18-19/h3-7,9H,8H2,1-2H3,(H,18,20).
What are the key properties of 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione?
2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione has a molecular weight of 347.21 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-3,3-dimethyl-4H-naphthalen-1-yl)-1H-pyridazine-3,6-dione is sourced from PubChem (CID 19887397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).