C14H22O6 — CID 19888184
3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 19888184) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 19888184 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCC(CO)(CO)CO.O=C1OC(=O)C2CCC=CC12 |
| InChI | InChI=1S/C8H8O3.C6H14O3/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-2-6(3-7,4-8)5-9/h1,3,5-6H,2,4H2;7-9H,2-5H2,1H3 |
| InChIKey | HTKSIUNGHIUJOQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|