About 2-methylprop-2-enoate;triethyl(methyl)azanium
2-methylprop-2-enoate;triethyl(methyl)azanium (PubChem CID 19888199) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-methylprop-2-enoate;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | 2-methylprop-2-enoate;triethyl(methyl)azanium |
| PubChem CID | 19888199 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2-methylprop-2-enoate;triethyl(methyl)azanium |
| SMILES | C=C(C)C(=O)[O-].CC[N+](C)(CC)CC |
| InChI | InChI=1S/C7H18N.C4H6O2/c1-5-8(4,6-2)7-3;1-3(2)4(5)6/h5-7H2,1-4H3;1H2,2H3,(H,5,6)/q+1;/p-1 |
| InChIKey | RFIIUAJGZZBDSD-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoate;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoate;triethyl(methyl)azanium?
The IUPAC name of 2-methylprop-2-enoate;triethyl(methyl)azanium (CID 19888199) is 2-methylprop-2-enoate;triethyl(methyl)azanium.
What is the SMILES notation for 2-methylprop-2-enoate;triethyl(methyl)azanium?
The canonical SMILES for 2-methylprop-2-enoate;triethyl(methyl)azanium is C=C(C)C(=O)[O-].CC[N+](C)(CC)CC.
What is the InChIKey of 2-methylprop-2-enoate;triethyl(methyl)azanium?
The InChIKey is RFIIUAJGZZBDSD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H18N.C4H6O2/c1-5-8(4,6-2)7-3;1-3(2)4(5)6/h5-7H2,1-4H3;1H2,2H3,(H,5,6)/q+1;/p-1.
What are the key properties of 2-methylprop-2-enoate;triethyl(methyl)azanium?
2-methylprop-2-enoate;triethyl(methyl)azanium has a molecular weight of 201.31 g/mol, XLogP of 0.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoate;triethyl(methyl)azanium is sourced from PubChem (CID 19888199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).